C20H17N5O3 — CID 175438375
1-[(4-methoxyanilino)carbamoyl]-9H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 175438375) has the molecular formula C20H17N5O3 and a molecular weight of 375.39 g/mol. Its IUPAC name is 1-[(4-methoxyanilino)carbamoyl]-9H-pyrido[3,4-b]indole-3-carboxamide.
| Compound Name | 1-[(4-methoxyanilino)carbamoyl]-9H-pyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 175438375 |
| Molecular Formula | C20H17N5O3 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 1-[(4-methoxyanilino)carbamoyl]-9H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | COc1ccc(NNC(=O)c2nc(C(N)=O)cc3c2[nH]c2ccccc23)cc1 |
| InChI | InChI=1S/C20H17N5O3/c1-28-12-8-6-11(7-9-12)24-25-20(27)18-17-14(10-16(23-18)19(21)26)13-4-2-3-5-15(13)22-17/h2-10,22,24H,1H3,(H2,21,26)(H,25,27) |
| InChIKey | WWLMOVLQCRFHPY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|