C18H19N3O3 — CID 146382280
methyl 1-(diethylcarbamoyl)-9H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 146382280) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is methyl 1-(diethylcarbamoyl)-9H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl 1-(diethylcarbamoyl)-9H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 146382280 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | methyl 1-(diethylcarbamoyl)-9H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | CCN(CC)C(=O)c1nc(C(=O)OC)cc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C18H19N3O3/c1-4-21(5-2)17(22)16-15-12(10-14(20-16)18(23)24-3)11-8-6-7-9-13(11)19-15/h6-10,19H,4-5H2,1-3H3 |
| InChIKey | SDUCCVROEKTEIC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |