C20H14F3N5O3 — CID 175438296
1-[[4-(trifluoromethoxy)anilino]carbamoyl]-9H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 175438296) has the molecular formula C20H14F3N5O3 and a molecular weight of 429.36 g/mol. Its IUPAC name is 1-[[4-(trifluoromethoxy)anilino]carbamoyl]-9H-pyrido[3,4-b]indole-3-carboxamide.
| Compound Name | 1-[[4-(trifluoromethoxy)anilino]carbamoyl]-9H-pyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 175438296 |
| Molecular Formula | C20H14F3N5O3 |
| Molecular Weight | 429.36 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 1-[[4-(trifluoromethoxy)anilino]carbamoyl]-9H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | NC(=O)c1cc2c([nH]c3ccccc32)c(C(=O)NNc2ccc(OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C20H14F3N5O3/c21-20(22,23)31-11-7-5-10(6-8-11)27-28-19(30)17-16-13(9-15(26-17)18(24)29)12-3-1-2-4-14(12)25-16/h1-9,25,27H,(H2,24,29)(H,28,30) |
| InChIKey | ONYCMIOLULGXMQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|