C18H13FN4O — CID 141453848
1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole-3-carbohydrazide (PubChem CID 141453848) has the molecular formula C18H13FN4O and a molecular weight of 320.33 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole-3-carbohydrazide.
| Compound Name | 1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole-3-carbohydrazide |
|---|---|
| PubChem CID | 141453848 |
| Molecular Formula | C18H13FN4O |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole-3-carbohydrazide |
| SMILES | NNC(=O)c1cc2c([nH]c3ccccc32)c(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C18H13FN4O/c19-11-7-5-10(6-8-11)16-17-13(9-15(22-16)18(24)23-20)12-3-1-2-4-14(12)21-17/h1-9,21H,20H2,(H,23,24) |
| InChIKey | DJMKNZVRNBPPIX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|