About 1-phenyl-N-propan-2-yl-9H-pyrido[3,4-b]indole-3-carboxamide
1-phenyl-N-propan-2-yl-9H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 172843390) has the molecular formula C21H19N3O
and a molecular weight of 329.40 g/mol. Its IUPAC name is 1-phenyl-N-propan-2-yl-9H-pyrido[3,4-b]indole-3-carboxamide.
Molecular Properties
| Compound Name | 1-phenyl-N-propan-2-yl-9H-pyrido[3,4-b]indole-3-carboxamide |
| PubChem CID | 172843390 |
| Molecular Formula | C21H19N3O |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 1-phenyl-N-propan-2-yl-9H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | CC(C)NC(=O)c1cc2c([nH]c3ccccc32)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H19N3O/c1-13(2)22-21(25)18-12-16-15-10-6-7-11-17(15)23-20(16)19(24-18)14-8-4-3-5-9-14/h3-13,23H,1-2H3,(H,22,25) |
| InChIKey | XCDPHNPZARJRSP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-phenyl-N-propan-2-yl-9H-pyrido[3,4-b]indole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-N-propan-2-yl-9H-pyrido[3,4-b]indole-3-carboxamide?
The IUPAC name of 1-phenyl-N-propan-2-yl-9H-pyrido[3,4-b]indole-3-carboxamide (CID 172843390) is 1-phenyl-N-propan-2-yl-9H-pyrido[3,4-b]indole-3-carboxamide.
What is the SMILES notation for 1-phenyl-N-propan-2-yl-9H-pyrido[3,4-b]indole-3-carboxamide?
The canonical SMILES for 1-phenyl-N-propan-2-yl-9H-pyrido[3,4-b]indole-3-carboxamide is CC(C)NC(=O)c1cc2c([nH]c3ccccc32)c(-c2ccccc2)n1.
What is the InChIKey of 1-phenyl-N-propan-2-yl-9H-pyrido[3,4-b]indole-3-carboxamide?
The InChIKey is XCDPHNPZARJRSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3O/c1-13(2)22-21(25)18-12-16-15-10-6-7-11-17(15)23-20(16)19(24-18)14-8-4-3-5-9-14/h3-13,23H,1-2H3,(H,22,25).
What are the key properties of 1-phenyl-N-propan-2-yl-9H-pyrido[3,4-b]indole-3-carboxamide?
1-phenyl-N-propan-2-yl-9H-pyrido[3,4-b]indole-3-carboxamide has a molecular weight of 329.40 g/mol, XLogP of 4.52, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-N-propan-2-yl-9H-pyrido[3,4-b]indole-3-carboxamide is sourced from PubChem (CID 172843390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).