C31H28N4O5 — CID 141266926
benzyl (2S)-4-methyl-2-[[1-(4-nitrophenyl)-9H-pyrido[3,4-b]indole-3-carbonyl]amino]pentanoate (PubChem CID 141266926) has the molecular formula C31H28N4O5 and a molecular weight of 536.59 g/mol. Its IUPAC name is benzyl (2S)-4-methyl-2-[[1-(4-nitrophenyl)-9H-pyrido[3,4-b]indole-3-carbonyl]amino]pentanoate.
| Compound Name | benzyl (2S)-4-methyl-2-[[1-(4-nitrophenyl)-9H-pyrido[3,4-b]indole-3-carbonyl]amino]pentanoate |
|---|---|
| PubChem CID | 141266926 |
| Molecular Formula | C31H28N4O5 |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | benzyl (2S)-4-methyl-2-[[1-(4-nitrophenyl)-9H-pyrido[3,4-b]indole-3-carbonyl]amino]pentanoate |
| SMILES | CC(C)C[C@H](NC(=O)c1cc2c([nH]c3ccccc32)c(-c2ccc([N+](=O)[O-])cc2)n1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H28N4O5/c1-19(2)16-27(31(37)40-18-20-8-4-3-5-9-20)34-30(36)26-17-24-23-10-6-7-11-25(23)32-29(24)28(33-26)21-12-14-22(15-13-21)35(38)39/h3-15,17,19,27,32H,16,18H2,1-2H3,(H,34,36)/t27-/m0/s1 |
| InChIKey | ZQFBFVOFMPLPTP-MHZLTWQESA-N |
| XLogP | 6.18 |
| TPSA | 127.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|