C30H25N5O6 — CID 141266925
benzyl (2S)-5-amino-2-[[1-(4-nitrophenyl)-9H-pyrido[3,4-b]indole-3-carbonyl]amino]-5-oxopentanoate (PubChem CID 141266925) has the molecular formula C30H25N5O6 and a molecular weight of 551.56 g/mol. Its IUPAC name is benzyl (2S)-5-amino-2-[[1-(4-nitrophenyl)-9H-pyrido[3,4-b]indole-3-carbonyl]amino]-5-oxopentanoate.
| Compound Name | benzyl (2S)-5-amino-2-[[1-(4-nitrophenyl)-9H-pyrido[3,4-b]indole-3-carbonyl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 141266925 |
| Molecular Formula | C30H25N5O6 |
| Molecular Weight | 551.56 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | benzyl (2S)-5-amino-2-[[1-(4-nitrophenyl)-9H-pyrido[3,4-b]indole-3-carbonyl]amino]-5-oxopentanoate |
| SMILES | NC(=O)CC[C@H](NC(=O)c1cc2c([nH]c3ccccc32)c(-c2ccc([N+](=O)[O-])cc2)n1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H25N5O6/c31-26(36)15-14-24(30(38)41-17-18-6-2-1-3-7-18)34-29(37)25-16-22-21-8-4-5-9-23(21)32-28(22)27(33-25)19-10-12-20(13-11-19)35(39)40/h1-13,16,24,32H,14-15,17H2,(H2,31,36)(H,34,37)/t24-/m0/s1 |
| InChIKey | VUMKWWGBUFIKMA-DEOSSOPVSA-N |
| XLogP | 4.40 |
| TPSA | 170.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.56 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|