C27H28N4O4 — CID 141467666
benzyl (2S)-2-[(1-acetyl-9H-pyrido[3,4-b]indole-3-carbonyl)amino]-6-aminohexanoate (PubChem CID 141467666) has the molecular formula C27H28N4O4 and a molecular weight of 472.55 g/mol. Its IUPAC name is benzyl (2S)-2-[(1-acetyl-9H-pyrido[3,4-b]indole-3-carbonyl)amino]-6-aminohexanoate.
| Compound Name | benzyl (2S)-2-[(1-acetyl-9H-pyrido[3,4-b]indole-3-carbonyl)amino]-6-aminohexanoate |
|---|---|
| PubChem CID | 141467666 |
| Molecular Formula | C27H28N4O4 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | benzyl (2S)-2-[(1-acetyl-9H-pyrido[3,4-b]indole-3-carbonyl)amino]-6-aminohexanoate |
| SMILES | CC(=O)c1nc(C(=O)N[C@@H](CCCCN)C(=O)OCc2ccccc2)cc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C27H28N4O4/c1-17(32)24-25-20(19-11-5-6-12-21(19)29-25)15-23(30-24)26(33)31-22(13-7-8-14-28)27(34)35-16-18-9-3-2-4-10-18/h2-6,9-12,15,22,29H,7-8,13-14,16,28H2,1H3,(H,31,33)/t22-/m0/s1 |
| InChIKey | SRKMKPXBNGWBGD-QFIPXVFZSA-N |
| XLogP | 3.89 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|