C31H29N7O5 — CID 141266905
benzyl (2S)-5-(diaminomethylideneamino)-2-[[1-(4-nitrophenyl)-9H-pyrido[3,4-b]indole-3-carbonyl]amino]pentanoate (PubChem CID 141266905) has the molecular formula C31H29N7O5 and a molecular weight of 579.62 g/mol. Its IUPAC name is benzyl (2S)-5-(diaminomethylideneamino)-2-[[1-(4-nitrophenyl)-9H-pyrido[3,4-b]indole-3-carbonyl]amino]pentanoate.
| Compound Name | benzyl (2S)-5-(diaminomethylideneamino)-2-[[1-(4-nitrophenyl)-9H-pyrido[3,4-b]indole-3-carbonyl]amino]pentanoate |
|---|---|
| PubChem CID | 141266905 |
| Molecular Formula | C31H29N7O5 |
| Molecular Weight | 579.62 g/mol |
| Exact Mass | 579.22 |
| IUPAC Name | benzyl (2S)-5-(diaminomethylideneamino)-2-[[1-(4-nitrophenyl)-9H-pyrido[3,4-b]indole-3-carbonyl]amino]pentanoate |
| SMILES | NC(N)=NCCC[C@H](NC(=O)c1cc2c([nH]c3ccccc32)c(-c2ccc([N+](=O)[O-])cc2)n1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H29N7O5/c32-31(33)34-16-6-11-25(30(40)43-18-19-7-2-1-3-8-19)37-29(39)26-17-23-22-9-4-5-10-24(22)35-28(23)27(36-26)20-12-14-21(15-13-20)38(41)42/h1-5,7-10,12-15,17,25,35H,6,11,16,18H2,(H,37,39)(H4,32,33,34)/t25-/m0/s1 |
| InChIKey | QZZHLMYPVWGZDU-VWLOTQADSA-N |
| XLogP | 4.19 |
| TPSA | 191.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.62 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|