C35H37ClN6O2 — CID 177374837
N-[(2S)-5-[(1-amino-2-chloroethylidene)amino]-1-(benzylamino)-1-oxopentan-2-yl]-1-(4-propan-2-ylphenyl)-9H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 177374837) has the molecular formula C35H37ClN6O2 and a molecular weight of 609.17 g/mol. Its IUPAC name is N-[(2S)-5-[(1-amino-2-chloroethylidene)amino]-1-(benzylamino)-1-oxopentan-2-yl]-1-(4-propan-2-ylphenyl)-9H-pyrido[3,4-b]indole-3-carboxamide.
| Compound Name | N-[(2S)-5-[(1-amino-2-chloroethylidene)amino]-1-(benzylamino)-1-oxopentan-2-yl]-1-(4-propan-2-ylphenyl)-9H-pyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 177374837 |
| Molecular Formula | C35H37ClN6O2 |
| Molecular Weight | 609.17 g/mol |
| Exact Mass | 608.27 |
| IUPAC Name | N-[(2S)-5-[(1-amino-2-chloroethylidene)amino]-1-(benzylamino)-1-oxopentan-2-yl]-1-(4-propan-2-ylphenyl)-9H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | CC(C)c1ccc(-c2nc(C(=O)N[C@@H](CCC/N=C(/N)CCl)C(=O)NCc3ccccc3)cc3c2[nH]c2ccccc23)cc1 |
| InChI | InChI=1S/C35H37ClN6O2/c1-22(2)24-14-16-25(17-15-24)32-33-27(26-11-6-7-12-28(26)40-33)19-30(41-32)35(44)42-29(13-8-18-38-31(37)20-36)34(43)39-21-23-9-4-3-5-10-23/h3-7,9-12,14-17,19,22,29,40H,8,13,18,20-21H2,1-2H3,(H2,37,38)(H,39,43)(H,42,44)/t29-/m0/s1 |
| InChIKey | RCLARCLPTIUJGB-LJAQVGFWSA-N |
| XLogP | 6.30 |
| TPSA | 125.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.17 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|