C19H26N6O3 — CID 97312317
N-[(2R)-5-(diaminomethylideneamino)-1-(2-hydroxyethylamino)-1-oxopentan-2-yl]-5-phenyl-1H-pyrrole-2-carboxamide (PubChem CID 97312317) has the molecular formula C19H26N6O3 and a molecular weight of 386.46 g/mol. Its IUPAC name is N-[(2R)-5-(diaminomethylideneamino)-1-(2-hydroxyethylamino)-1-oxopentan-2-yl]-5-phenyl-1H-pyrrole-2-carboxamide.
| Compound Name | N-[(2R)-5-(diaminomethylideneamino)-1-(2-hydroxyethylamino)-1-oxopentan-2-yl]-5-phenyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 97312317 |
| Molecular Formula | C19H26N6O3 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | N-[(2R)-5-(diaminomethylideneamino)-1-(2-hydroxyethylamino)-1-oxopentan-2-yl]-5-phenyl-1H-pyrrole-2-carboxamide |
| SMILES | NC(N)=NCCC[C@@H](NC(=O)c1ccc(-c2ccccc2)[nH]1)C(=O)NCCO |
| InChI | InChI=1S/C19H26N6O3/c20-19(21)23-10-4-7-15(17(27)22-11-12-26)25-18(28)16-9-8-14(24-16)13-5-2-1-3-6-13/h1-3,5-6,8-9,15,24,26H,4,7,10-12H2,(H,22,27)(H,25,28)(H4,20,21,23)/t15-/m1/s1 |
| InChIKey | ICYVAINGGCXNEB-OAHLLOKOSA-N |
| XLogP | -0.06 |
| TPSA | 158.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|