C20H29N7O3S — CID 145265796
N-[5-(diaminomethylideneamino)-1-[2-(methanesulfinamido)ethylamino]-1-oxopentan-2-yl]-5-phenyl-1H-pyrrole-2-carboxamide (PubChem CID 145265796) has the molecular formula C20H29N7O3S and a molecular weight of 447.57 g/mol. Its IUPAC name is N-[5-(diaminomethylideneamino)-1-[2-(methanesulfinamido)ethylamino]-1-oxopentan-2-yl]-5-phenyl-1H-pyrrole-2-carboxamide.
| Compound Name | N-[5-(diaminomethylideneamino)-1-[2-(methanesulfinamido)ethylamino]-1-oxopentan-2-yl]-5-phenyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 145265796 |
| Molecular Formula | C20H29N7O3S |
| Molecular Weight | 447.57 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | N-[5-(diaminomethylideneamino)-1-[2-(methanesulfinamido)ethylamino]-1-oxopentan-2-yl]-5-phenyl-1H-pyrrole-2-carboxamide |
| SMILES | CS(=O)NCCNC(=O)C(CCCN=C(N)N)NC(=O)c1ccc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C20H29N7O3S/c1-31(30)25-13-12-23-18(28)16(8-5-11-24-20(21)22)27-19(29)17-10-9-15(26-17)14-6-3-2-4-7-14/h2-4,6-7,9-10,16,25-26H,5,8,11-13H2,1H3,(H,23,28)(H,27,29)(H4,21,22,24) |
| InChIKey | WTKCPFAYVBEJRI-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 167.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.57 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|