C24H29ClN7O3- — CID 10163890
N-[(2S)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1H-indole-2-carboxamide chloride (PubChem CID 10163890) has the molecular formula C24H29ClN7O3- and a molecular weight of 499.00 g/mol. Its IUPAC name is N-[(2S)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1H-indole-2-carboxamide chloride.
| Compound Name | N-[(2S)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1H-indole-2-carboxamide chloride |
|---|---|
| PubChem CID | 10163890 |
| Molecular Formula | C24H29ClN7O3- |
| Molecular Weight | 499.00 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | N-[(2S)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1H-indole-2-carboxamide chloride |
| SMILES | NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCN=C(N)N)NC(=O)c1cc2ccccc2[nH]1.[Cl-] |
| InChI | InChI=1S/C24H29N7O3.ClH/c25-21(32)19(13-15-7-2-1-3-8-15)31-22(33)18(11-6-12-28-24(26)27)30-23(34)20-14-16-9-4-5-10-17(16)29-20;/h1-5,7-10,14,18-19,29H,6,11-13H2,(H2,25,32)(H,30,34)(H,31,33)(H4,26,27,28);1H/p-1/t18-,19-;/m0./s1 |
| InChIKey | WFANHYWBUYIVNJ-HLRBRJAUSA-M |
| XLogP | -2.46 |
| TPSA | 181.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.00 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|