C22H27ClN6O3 — CID 10278299
N-[(2S)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-3-chlorobenzamide (PubChem CID 10278299) has the molecular formula C22H27ClN6O3 and a molecular weight of 458.95 g/mol. Its IUPAC name is N-[(2S)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-3-chlorobenzamide.
| Compound Name | N-[(2S)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 10278299 |
| Molecular Formula | C22H27ClN6O3 |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | N-[(2S)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-3-chlorobenzamide |
| SMILES | NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCN=C(N)N)NC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H27ClN6O3/c23-16-9-4-8-15(13-16)20(31)28-17(10-5-11-27-22(25)26)21(32)29-18(19(24)30)12-14-6-2-1-3-7-14/h1-4,6-9,13,17-18H,5,10-12H2,(H2,24,30)(H,28,31)(H,29,32)(H4,25,26,27)/t17-,18-/m0/s1 |
| InChIKey | OSDMSXDHTVVCCC-ROUUACIJSA-N |
| XLogP | 0.70 |
| TPSA | 165.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|