C24H29N7O3 — CID 71457908
N-[(2S)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1H-indole-6-carboxamide (PubChem CID 71457908) has the molecular formula C24H29N7O3 and a molecular weight of 463.54 g/mol. Its IUPAC name is N-[(2S)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1H-indole-6-carboxamide.
| Compound Name | N-[(2S)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 71457908 |
| Molecular Formula | C24H29N7O3 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | N-[(2S)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1H-indole-6-carboxamide |
| SMILES | NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCN=C(N)N)NC(=O)c1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C24H29N7O3/c25-21(32)20(13-15-5-2-1-3-6-15)31-23(34)18(7-4-11-29-24(26)27)30-22(33)17-9-8-16-10-12-28-19(16)14-17/h1-3,5-6,8-10,12,14,18,20,28H,4,7,11,13H2,(H2,25,32)(H,30,33)(H,31,34)(H4,26,27,29)/t18-,20-/m0/s1 |
| InChIKey | ZSSSDFBULLPCJZ-ICSRJNTNSA-N |
| XLogP | 0.53 |
| TPSA | 181.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|