C21H17N3O3 — CID 6235795
2-[(1-phenyl-9H-pyrido[3,4-b]indole-3-carbonyl)amino]propanoic acid (PubChem CID 6235795) has the molecular formula C21H17N3O3 and a molecular weight of 359.39 g/mol. Its IUPAC name is 2-[(1-phenyl-9H-pyrido[3,4-b]indole-3-carbonyl)amino]propanoic acid.
| Compound Name | 2-[(1-phenyl-9H-pyrido[3,4-b]indole-3-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 6235795 |
| Molecular Formula | C21H17N3O3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 2-[(1-phenyl-9H-pyrido[3,4-b]indole-3-carbonyl)amino]propanoic acid |
| SMILES | CC(NC(=O)c1cc2c([nH]c3ccccc32)c(-c2ccccc2)n1)C(=O)O |
| InChI | InChI=1S/C21H17N3O3/c1-12(21(26)27)22-20(25)17-11-15-14-9-5-6-10-16(14)23-19(15)18(24-17)13-7-3-2-4-8-13/h2-12,23H,1H3,(H,22,25)(H,26,27) |
| InChIKey | GKMBYFKDZMNKMW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |