C18H23N6O3Rf- — CID 59916851
N-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-ethoxyquinoline-2-carboxamide;rutherfordium (PubChem CID 59916851) has the molecular formula C18H23N6O3Rf- and a molecular weight of 638.42 g/mol. Its IUPAC name is N-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-ethoxyquinoline-2-carboxamide;rutherfordium.
| Compound Name | N-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-ethoxyquinoline-2-carboxamide;rutherfordium |
|---|---|
| PubChem CID | 59916851 |
| Molecular Formula | C18H23N6O3Rf- |
| Molecular Weight | 638.42 g/mol |
| Exact Mass | 638.31 |
| IUPAC Name | N-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-ethoxyquinoline-2-carboxamide;rutherfordium |
| SMILES | [CH2-]COc1cc(C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)nc2ccccc12.[Rf] |
| InChI | InChI=1S/C18H23N6O3.Rf/c1-2-27-15-10-14(23-12-7-4-3-6-11(12)15)17(26)24-13(16(19)25)8-5-9-22-18(20)21;/h3-4,6-7,10,13H,1-2,5,8-9H2,(H2,19,25)(H,24,26)(H4,20,21,22);/q-1;/t13-;/m0./s1 |
| InChIKey | CGADTPYTNPUQMW-ZOWNYOTGSA-N |
| XLogP | 0.08 |
| TPSA | 158.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.42 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|