C24H30N8O3 — CID 90681325
N-[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-3-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]benzamide (PubChem CID 90681325) has the molecular formula C24H30N8O3 and a molecular weight of 478.56 g/mol. Its IUPAC name is N-[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-3-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]benzamide.
| Compound Name | N-[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-3-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]benzamide |
|---|---|
| PubChem CID | 90681325 |
| Molecular Formula | C24H30N8O3 |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | N-[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-3-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]benzamide |
| SMILES | NC(=O)C(CCCN=C(N)N)NC(=O)c1cccc(NC(=O)C(N)Cc2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C24H30N8O3/c25-18(12-15-13-30-19-8-2-1-7-17(15)19)23(35)31-16-6-3-5-14(11-16)22(34)32-20(21(26)33)9-4-10-29-24(27)28/h1-3,5-8,11,13,18,20,30H,4,9-10,12,25H2,(H2,26,33)(H,31,35)(H,32,34)(H4,27,28,29) |
| InChIKey | QCLZMOVVSXGSEJ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 207.50 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|