C27H31N7O2 — CID 58887379
(2S)-2-amino-5-(diaminomethylideneamino)-N-[(2S)-3-(1H-indol-3-yl)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl]pentanamide (PubChem CID 58887379) has the molecular formula C27H31N7O2 and a molecular weight of 485.59 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)-N-[(2S)-3-(1H-indol-3-yl)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl]pentanamide.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)-N-[(2S)-3-(1H-indol-3-yl)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl]pentanamide |
|---|---|
| PubChem CID | 58887379 |
| Molecular Formula | C27H31N7O2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)-N-[(2S)-3-(1H-indol-3-yl)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl]pentanamide |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H31N7O2/c28-22(9-5-13-31-27(29)30)25(35)34-24(15-19-16-32-23-10-4-3-8-21(19)23)26(36)33-20-12-11-17-6-1-2-7-18(17)14-20/h1-4,6-8,10-12,14,16,22,24,32H,5,9,13,15,28H2,(H,33,36)(H,34,35)(H4,29,30,31)/t22-,24-/m0/s1 |
| InChIKey | RTMRBNYZARYTGR-UPVQGACJSA-N |
| XLogP | 2.37 |
| TPSA | 164.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|