C18H14FN3 — CID 122185830
[1-(4-fluorophenyl)-9H-pyrido[3,4-b]indol-3-yl]methanamine (PubChem CID 122185830) has the molecular formula C18H14FN3 and a molecular weight of 291.33 g/mol. Its IUPAC name is [1-(4-fluorophenyl)-9H-pyrido[3,4-b]indol-3-yl]methanamine.
| Compound Name | [1-(4-fluorophenyl)-9H-pyrido[3,4-b]indol-3-yl]methanamine |
|---|---|
| PubChem CID | 122185830 |
| Molecular Formula | C18H14FN3 |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | [1-(4-fluorophenyl)-9H-pyrido[3,4-b]indol-3-yl]methanamine |
| SMILES | NCc1cc2c([nH]c3ccccc32)c(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C18H14FN3/c19-12-7-5-11(6-8-12)17-18-15(9-13(10-20)21-17)14-3-1-2-4-16(14)22-18/h1-9,22H,10,20H2 |
| InChIKey | QQXOJPNWJZOWRX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |