C18H13ClN2O — CID 10686284
[1-(2-chlorophenyl)-9H-pyrido[3,4-b]indol-3-yl]methanol (PubChem CID 10686284) has the molecular formula C18H13ClN2O and a molecular weight of 308.77 g/mol. Its IUPAC name is [1-(2-chlorophenyl)-9H-pyrido[3,4-b]indol-3-yl]methanol.
| Compound Name | [1-(2-chlorophenyl)-9H-pyrido[3,4-b]indol-3-yl]methanol |
|---|---|
| PubChem CID | 10686284 |
| Molecular Formula | C18H13ClN2O |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | [1-(2-chlorophenyl)-9H-pyrido[3,4-b]indol-3-yl]methanol |
| SMILES | OCc1cc2c([nH]c3ccccc32)c(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C18H13ClN2O/c19-15-7-3-1-6-13(15)17-18-14(9-11(10-22)20-17)12-5-2-4-8-16(12)21-18/h1-9,21-22H,10H2 |
| InChIKey | RUWPSOLHQZSNFQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |