C21H14ClN5O2S — CID 137314382
1-(2-chlorophenyl)-N-[(Z)-(4-oxo-1,3-thiazolidin-2-ylidene)amino]-9H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 137314382) has the molecular formula C21H14ClN5O2S and a molecular weight of 435.90 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-[(Z)-(4-oxo-1,3-thiazolidin-2-ylidene)amino]-9H-pyrido[3,4-b]indole-3-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-N-[(Z)-(4-oxo-1,3-thiazolidin-2-ylidene)amino]-9H-pyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 137314382 |
| Molecular Formula | C21H14ClN5O2S |
| Molecular Weight | 435.90 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | 1-(2-chlorophenyl)-N-[(Z)-(4-oxo-1,3-thiazolidin-2-ylidene)amino]-9H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | O=C1CS/C(=N\NC(=O)c2cc3c([nH]c4ccccc43)c(-c3ccccc3Cl)n2)N1 |
| InChI | InChI=1S/C21H14ClN5O2S/c22-14-7-3-1-6-12(14)18-19-13(11-5-2-4-8-15(11)23-19)9-16(24-18)20(29)26-27-21-25-17(28)10-30-21/h1-9,23H,10H2,(H,26,29)(H,25,27,28) |
| InChIKey | TWHMROASQFIUBM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.90 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|