C25H18N2O2 — CID 175115962
1-(2-benzylphenyl)-9H-pyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 175115962) has the molecular formula C25H18N2O2 and a molecular weight of 378.43 g/mol. Its IUPAC name is 1-(2-benzylphenyl)-9H-pyrido[3,4-b]indole-3-carboxylic acid.
| Compound Name | 1-(2-benzylphenyl)-9H-pyrido[3,4-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 175115962 |
| Molecular Formula | C25H18N2O2 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 1-(2-benzylphenyl)-9H-pyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | O=C(O)c1cc2c([nH]c3ccccc32)c(-c2ccccc2Cc2ccccc2)n1 |
| InChI | InChI=1S/C25H18N2O2/c28-25(29)22-15-20-19-12-6-7-13-21(19)26-24(20)23(27-22)18-11-5-4-10-17(18)14-16-8-2-1-3-9-16/h1-13,15,26H,14H2,(H,28,29) |
| InChIKey | HWBVLJRBEGCTLQ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |