C12H10N2O2 — CID 135059722
3-(hydroxymethyl)-2,9-dihydropyrido[3,4-b]indol-1-one (PubChem CID 135059722) has the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. Its IUPAC name is 3-(hydroxymethyl)-2,9-dihydropyrido[3,4-b]indol-1-one.
| Compound Name | 3-(hydroxymethyl)-2,9-dihydropyrido[3,4-b]indol-1-one |
|---|---|
| PubChem CID | 135059722 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 3-(hydroxymethyl)-2,9-dihydropyrido[3,4-b]indol-1-one |
| SMILES | O=c1[nH]c(CO)cc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C12H10N2O2/c15-6-7-5-9-8-3-1-2-4-10(8)14-11(9)12(16)13-7/h1-5,14-15H,6H2,(H,13,16) |
| InChIKey | LTKUZYBKSUAZKD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |