C22H16N2O — CID 72946438
(1-naphthalen-2-yl-9H-pyrido[3,4-b]indol-3-yl)methanol (PubChem CID 72946438) has the molecular formula C22H16N2O and a molecular weight of 324.38 g/mol. Its IUPAC name is (1-naphthalen-2-yl-9H-pyrido[3,4-b]indol-3-yl)methanol.
| Compound Name | (1-naphthalen-2-yl-9H-pyrido[3,4-b]indol-3-yl)methanol |
|---|---|
| PubChem CID | 72946438 |
| Molecular Formula | C22H16N2O |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | (1-naphthalen-2-yl-9H-pyrido[3,4-b]indol-3-yl)methanol |
| SMILES | OCc1cc2c([nH]c3ccccc32)c(-c2ccc3ccccc3c2)n1 |
| InChI | InChI=1S/C22H16N2O/c25-13-17-12-19-18-7-3-4-8-20(18)24-22(19)21(23-17)16-10-9-14-5-1-2-6-15(14)11-16/h1-12,24-25H,13H2 |
| InChIKey | LHTXSGYVZKWUCG-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |