C20H13N3O — CID 135900483
1-naphthalen-2-yl-3,5-dihydropyridazino[4,5-b]indol-4-one (PubChem CID 135900483) has the molecular formula C20H13N3O and a molecular weight of 311.34 g/mol. Its IUPAC name is 1-naphthalen-2-yl-3,5-dihydropyridazino[4,5-b]indol-4-one.
| Compound Name | 1-naphthalen-2-yl-3,5-dihydropyridazino[4,5-b]indol-4-one |
|---|---|
| PubChem CID | 135900483 |
| Molecular Formula | C20H13N3O |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 1-naphthalen-2-yl-3,5-dihydropyridazino[4,5-b]indol-4-one |
| SMILES | O=c1[nH]nc(-c2ccc3ccccc3c2)c2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C20H13N3O/c24-20-19-17(15-7-3-4-8-16(15)21-19)18(22-23-20)14-10-9-12-5-1-2-6-13(12)11-14/h1-11,21H,(H,23,24) |
| InChIKey | FTVDAALOROYEML-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |