C18H11N5O — CID 135900468
4-quinoxalin-2-yl-2,5-dihydropyridazino[4,5-b]indol-1-one (PubChem CID 135900468) has the molecular formula C18H11N5O and a molecular weight of 313.32 g/mol. Its IUPAC name is 4-quinoxalin-2-yl-2,5-dihydropyridazino[4,5-b]indol-1-one.
| Compound Name | 4-quinoxalin-2-yl-2,5-dihydropyridazino[4,5-b]indol-1-one |
|---|---|
| PubChem CID | 135900468 |
| Molecular Formula | C18H11N5O |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 4-quinoxalin-2-yl-2,5-dihydropyridazino[4,5-b]indol-1-one |
| SMILES | O=c1[nH]nc(-c2cnc3ccccc3n2)c2[nH]c3ccccc3c12 |
| InChI | InChI=1S/C18H11N5O/c24-18-15-10-5-1-2-6-11(10)21-17(15)16(22-23-18)14-9-19-12-7-3-4-8-13(12)20-14/h1-9,21H,(H,23,24) |
| InChIKey | ORKSCVIMWMBJSV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |