C16H11N3S — CID 135541581
4-phenyl-2,5-dihydropyridazino[4,5-b]indole-1-thione (PubChem CID 135541581) has the molecular formula C16H11N3S and a molecular weight of 277.35 g/mol. Its IUPAC name is 4-phenyl-2,5-dihydropyridazino[4,5-b]indole-1-thione.
| Compound Name | 4-phenyl-2,5-dihydropyridazino[4,5-b]indole-1-thione |
|---|---|
| PubChem CID | 135541581 |
| Molecular Formula | C16H11N3S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 4-phenyl-2,5-dihydropyridazino[4,5-b]indole-1-thione |
| SMILES | S=c1[nH]nc(-c2ccccc2)c2[nH]c3ccccc3c12 |
| InChI | InChI=1S/C16H11N3S/c20-16-13-11-8-4-5-9-12(11)17-15(13)14(18-19-16)10-6-2-1-3-7-10/h1-9,17H,(H,19,20) |
| InChIKey | XCMPOIWWEGPJBW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|