C17H11N3O2 — CID 101095307
4-pyridin-3-yl-10H-azepino[3,4-b]indole-1,3-dione (PubChem CID 101095307) has the molecular formula C17H11N3O2 and a molecular weight of 289.29 g/mol. Its IUPAC name is 4-pyridin-3-yl-10H-azepino[3,4-b]indole-1,3-dione.
| Compound Name | 4-pyridin-3-yl-10H-azepino[3,4-b]indole-1,3-dione |
|---|---|
| PubChem CID | 101095307 |
| Molecular Formula | C17H11N3O2 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 4-pyridin-3-yl-10H-azepino[3,4-b]indole-1,3-dione |
| SMILES | O=c1[nH]c(=O)c2[nH]c3ccccc3c2cc1-c1cccnc1 |
| InChI | InChI=1S/C17H11N3O2/c21-16-12(10-4-3-7-18-9-10)8-13-11-5-1-2-6-14(11)19-15(13)17(22)20-16/h1-9,19H,(H,20,21,22) |
| InChIKey | GMWGLPSUKPCTQH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |