C21H23NO6 — CID 14469073
triethyl 5-methyl-4-phenylpyridine-2,3,6-tricarboxylate (PubChem CID 14469073) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is triethyl 5-methyl-4-phenylpyridine-2,3,6-tricarboxylate.
| Compound Name | triethyl 5-methyl-4-phenylpyridine-2,3,6-tricarboxylate |
|---|---|
| PubChem CID | 14469073 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | triethyl 5-methyl-4-phenylpyridine-2,3,6-tricarboxylate |
| SMILES | CCOC(=O)c1nc(C(=O)OCC)c(C(=O)OCC)c(-c2ccccc2)c1C |
| InChI | InChI=1S/C21H23NO6/c1-5-26-19(23)16-15(14-11-9-8-10-12-14)13(4)17(20(24)27-6-2)22-18(16)21(25)28-7-3/h8-12H,5-7H2,1-4H3 |
| InChIKey | RPZATJVDDYWYQD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 91.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|