C20H23NO4 — CID 10521182
diethyl 2-ethyl-4-methyl-6-phenylpyridine-3,5-dicarboxylate (PubChem CID 10521182) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is diethyl 2-ethyl-4-methyl-6-phenylpyridine-3,5-dicarboxylate.
| Compound Name | diethyl 2-ethyl-4-methyl-6-phenylpyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 10521182 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | diethyl 2-ethyl-4-methyl-6-phenylpyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)c1c(CC)nc(-c2ccccc2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C20H23NO4/c1-5-15-16(19(22)24-6-2)13(4)17(20(23)25-7-3)18(21-15)14-11-9-8-10-12-14/h8-12H,5-7H2,1-4H3 |
| InChIKey | MDKOUAVKZJMWCD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |