C19H20ClNO4 — CID 122366670
diethyl 2-(4-chlorophenyl)-4,6-dimethylpyridine-3,5-dicarboxylate (PubChem CID 122366670) has the molecular formula C19H20ClNO4 and a molecular weight of 361.83 g/mol. Its IUPAC name is diethyl 2-(4-chlorophenyl)-4,6-dimethylpyridine-3,5-dicarboxylate.
| Compound Name | diethyl 2-(4-chlorophenyl)-4,6-dimethylpyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 122366670 |
| Molecular Formula | C19H20ClNO4 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | diethyl 2-(4-chlorophenyl)-4,6-dimethylpyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)c1c(C)nc(-c2ccc(Cl)cc2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C19H20ClNO4/c1-5-24-18(22)15-11(3)16(19(23)25-6-2)17(21-12(15)4)13-7-9-14(20)10-8-13/h7-10H,5-6H2,1-4H3 |
| InChIKey | QRBBKXGADBARPY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |