C29H22ClNO4 — CID 139217700
diethyl 3-(4-chlorophenyl)naphtho[2,3-f]quinoline-1,2-dicarboxylate (PubChem CID 139217700) has the molecular formula C29H22ClNO4 and a molecular weight of 483.95 g/mol. Its IUPAC name is diethyl 3-(4-chlorophenyl)naphtho[2,3-f]quinoline-1,2-dicarboxylate.
| Compound Name | diethyl 3-(4-chlorophenyl)naphtho[2,3-f]quinoline-1,2-dicarboxylate |
|---|---|
| PubChem CID | 139217700 |
| Molecular Formula | C29H22ClNO4 |
| Molecular Weight | 483.95 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | diethyl 3-(4-chlorophenyl)naphtho[2,3-f]quinoline-1,2-dicarboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Cl)cc2)nc2ccc3cc4ccccc4cc3c2c1C(=O)OCC |
| InChI | InChI=1S/C29H22ClNO4/c1-3-34-28(32)25-24-22-16-19-8-6-5-7-18(19)15-20(22)11-14-23(24)31-27(26(25)29(33)35-4-2)17-9-12-21(30)13-10-17/h5-16H,3-4H2,1-2H3 |
| InChIKey | AJJILSPNXHRTIQ-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.95 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|