C19H13Cl3N2O2 — CID 131866480
ethyl 4-[3,6-dichloro-5-(4-chlorophenyl)pyrazin-2-yl]benzoate (PubChem CID 131866480) has the molecular formula C19H13Cl3N2O2 and a molecular weight of 407.68 g/mol. Its IUPAC name is ethyl 4-[3,6-dichloro-5-(4-chlorophenyl)pyrazin-2-yl]benzoate.
| Compound Name | ethyl 4-[3,6-dichloro-5-(4-chlorophenyl)pyrazin-2-yl]benzoate |
|---|---|
| PubChem CID | 131866480 |
| Molecular Formula | C19H13Cl3N2O2 |
| Molecular Weight | 407.68 g/mol |
| Exact Mass | 406.00 |
| IUPAC Name | ethyl 4-[3,6-dichloro-5-(4-chlorophenyl)pyrazin-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2nc(Cl)c(-c3ccc(Cl)cc3)nc2Cl)cc1 |
| InChI | InChI=1S/C19H13Cl3N2O2/c1-2-26-19(25)13-5-3-11(4-6-13)15-17(21)24-16(18(22)23-15)12-7-9-14(20)10-8-12/h3-10H,2H2,1H3 |
| InChIKey | LHXKUFOTFOXMNQ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.68 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |