C14H15ClN2O2 — CID 69282792
ethyl 3-(4-chlorophenyl)-1,4-dimethylpyrazole-5-carboxylate (PubChem CID 69282792) has the molecular formula C14H15ClN2O2 and a molecular weight of 278.74 g/mol. Its IUPAC name is ethyl 3-(4-chlorophenyl)-1,4-dimethylpyrazole-5-carboxylate.
| Compound Name | ethyl 3-(4-chlorophenyl)-1,4-dimethylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 69282792 |
| Molecular Formula | C14H15ClN2O2 |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | ethyl 3-(4-chlorophenyl)-1,4-dimethylpyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1c(C)c(-c2ccc(Cl)cc2)nn1C |
| InChI | InChI=1S/C14H15ClN2O2/c1-4-19-14(18)13-9(2)12(16-17(13)3)10-5-7-11(15)8-6-10/h5-8H,4H2,1-3H3 |
| InChIKey | ZEHLUKCSIDPLFP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |