C21H30ClN5O2 — CID 132501111
ethyl 4-amino-3-(4-chlorophenyl)-1-[4-(4-methylpiperazin-1-yl)butyl]pyrazole-5-carboxylate (PubChem CID 132501111) has the molecular formula C21H30ClN5O2 and a molecular weight of 419.96 g/mol. Its IUPAC name is ethyl 4-amino-3-(4-chlorophenyl)-1-[4-(4-methylpiperazin-1-yl)butyl]pyrazole-5-carboxylate.
| Compound Name | ethyl 4-amino-3-(4-chlorophenyl)-1-[4-(4-methylpiperazin-1-yl)butyl]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 132501111 |
| Molecular Formula | C21H30ClN5O2 |
| Molecular Weight | 419.96 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | ethyl 4-amino-3-(4-chlorophenyl)-1-[4-(4-methylpiperazin-1-yl)butyl]pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1c(N)c(-c2ccc(Cl)cc2)nn1CCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C21H30ClN5O2/c1-3-29-21(28)20-18(23)19(16-6-8-17(22)9-7-16)24-27(20)11-5-4-10-26-14-12-25(2)13-15-26/h6-9H,3-5,10-15,23H2,1-2H3 |
| InChIKey | HPAWNKAYTPZNSD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 76.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.96 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|