C24H33N7O — CID 167297547
1-[4-[5-[4-amino-3-(4-methylphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]pentyl]piperazin-1-yl]propan-1-one (PubChem CID 167297547) has the molecular formula C24H33N7O and a molecular weight of 435.58 g/mol. Its IUPAC name is 1-[4-[5-[4-amino-3-(4-methylphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]pentyl]piperazin-1-yl]propan-1-one.
| Compound Name | 1-[4-[5-[4-amino-3-(4-methylphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]pentyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 167297547 |
| Molecular Formula | C24H33N7O |
| Molecular Weight | 435.58 g/mol |
| Exact Mass | 435.27 |
| IUPAC Name | 1-[4-[5-[4-amino-3-(4-methylphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]pentyl]piperazin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCN(CCCCCn2nc(-c3ccc(C)cc3)c3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C24H33N7O/c1-3-20(32)30-15-13-29(14-16-30)11-5-4-6-12-31-24-21(23(25)26-17-27-24)22(28-31)19-9-7-18(2)8-10-19/h7-10,17H,3-6,11-16H2,1-2H3,(H2,25,26,27) |
| InChIKey | ZCLJKEHGSPBFDO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.58 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|