C25H27F6N7O — CID 166627588
1-[4-[5-[4-amino-3-[3,5-bis(trifluoromethyl)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]pentyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 166627588) has the molecular formula C25H27F6N7O and a molecular weight of 555.53 g/mol. Its IUPAC name is 1-[4-[5-[4-amino-3-[3,5-bis(trifluoromethyl)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]pentyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[5-[4-amino-3-[3,5-bis(trifluoromethyl)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]pentyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166627588 |
| Molecular Formula | C25H27F6N7O |
| Molecular Weight | 555.53 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | 1-[4-[5-[4-amino-3-[3,5-bis(trifluoromethyl)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]pentyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(CCCCCn2nc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C25H27F6N7O/c1-2-19(39)37-10-8-36(9-11-37)6-4-3-5-7-38-23-20(22(32)33-15-34-23)21(35-38)16-12-17(24(26,27)28)14-18(13-16)25(29,30)31/h2,12-15H,1,3-11H2,(H2,32,33,34) |
| InChIKey | GTVVGKPRDJCRGQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.53 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|