C24H30F3N7O — CID 167125698
1-[4-[5-[[6-amino-5-[3-(trifluoromethyl)benzenecarboximidoyl]pyrimidin-4-yl]amino]pentyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 167125698) has the molecular formula C24H30F3N7O and a molecular weight of 489.55 g/mol. Its IUPAC name is 1-[4-[5-[[6-amino-5-[3-(trifluoromethyl)benzenecarboximidoyl]pyrimidin-4-yl]amino]pentyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[5-[[6-amino-5-[3-(trifluoromethyl)benzenecarboximidoyl]pyrimidin-4-yl]amino]pentyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167125698 |
| Molecular Formula | C24H30F3N7O |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | 1-[4-[5-[[6-amino-5-[3-(trifluoromethyl)benzenecarboximidoyl]pyrimidin-4-yl]amino]pentyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | [H]/N=C(\c1cccc(C(F)(F)F)c1)c1c(N)ncnc1NCCCCCN1CCN(C(=O)C=C)CC1 |
| InChI | InChI=1S/C24H30F3N7O/c1-2-19(35)34-13-11-33(12-14-34)10-5-3-4-9-30-23-20(22(29)31-16-32-23)21(28)17-7-6-8-18(15-17)24(25,26)27/h2,6-8,15-16,28H,1,3-5,9-14H2,(H3,29,30,31,32)/b28-21+ |
| InChIKey | LDDUJZJJYMQFEX-SGWCAAJKSA-N |
| XLogP | 3.41 |
| TPSA | 111.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|