C26H26ClFN6O2 — CID 130203319
1-[(3S)-3-[[6-amino-5-[3-chloro-4-[(3-fluorophenyl)methoxy]benzenecarboximidoyl]pyrimidin-4-yl]amino]piperidin-1-yl]prop-2-en-1-one (PubChem CID 130203319) has the molecular formula C26H26ClFN6O2 and a molecular weight of 508.99 g/mol. Its IUPAC name is 1-[(3S)-3-[[6-amino-5-[3-chloro-4-[(3-fluorophenyl)methoxy]benzenecarboximidoyl]pyrimidin-4-yl]amino]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3S)-3-[[6-amino-5-[3-chloro-4-[(3-fluorophenyl)methoxy]benzenecarboximidoyl]pyrimidin-4-yl]amino]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 130203319 |
| Molecular Formula | C26H26ClFN6O2 |
| Molecular Weight | 508.99 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | 1-[(3S)-3-[[6-amino-5-[3-chloro-4-[(3-fluorophenyl)methoxy]benzenecarboximidoyl]pyrimidin-4-yl]amino]piperidin-1-yl]prop-2-en-1-one |
| SMILES | [H]/N=C(\c1ccc(OCc2cccc(F)c2)c(Cl)c1)c1c(N)ncnc1N[C@H]1CCCN(C(=O)C=C)C1 |
| InChI | InChI=1S/C26H26ClFN6O2/c1-2-22(35)34-10-4-7-19(13-34)33-26-23(25(30)31-15-32-26)24(29)17-8-9-21(20(27)12-17)36-14-16-5-3-6-18(28)11-16/h2-3,5-6,8-9,11-12,15,19,29H,1,4,7,10,13-14H2,(H3,30,31,32,33)/b29-24+/t19-/m0/s1 |
| InChIKey | MPBLMLALSJOPHQ-WKKOBIEJSA-N |
| XLogP | 4.44 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.99 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|