C23H23FN6O2 — CID 144747008
3-[[6-amino-5-[4-(4-fluorophenoxy)benzenecarboximidoyl]pyrimidin-4-yl]amino]piperidine-1-carbaldehyde (PubChem CID 144747008) has the molecular formula C23H23FN6O2 and a molecular weight of 434.48 g/mol. Its IUPAC name is 3-[[6-amino-5-[4-(4-fluorophenoxy)benzenecarboximidoyl]pyrimidin-4-yl]amino]piperidine-1-carbaldehyde.
| Compound Name | 3-[[6-amino-5-[4-(4-fluorophenoxy)benzenecarboximidoyl]pyrimidin-4-yl]amino]piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 144747008 |
| Molecular Formula | C23H23FN6O2 |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 3-[[6-amino-5-[4-(4-fluorophenoxy)benzenecarboximidoyl]pyrimidin-4-yl]amino]piperidine-1-carbaldehyde |
| SMILES | [H]/N=C(\c1ccc(Oc2ccc(F)cc2)cc1)c1c(N)ncnc1NC1CCCN(C=O)C1 |
| InChI | InChI=1S/C23H23FN6O2/c24-16-5-9-19(10-6-16)32-18-7-3-15(4-8-18)21(25)20-22(26)27-13-28-23(20)29-17-2-1-11-30(12-17)14-31/h3-10,13-14,17,25H,1-2,11-12H2,(H3,26,27,28,29)/b25-21+ |
| InChIKey | HDGBEOJIEZBYSS-NJNXFGOHSA-N |
| XLogP | 3.44 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|