C20H22N6O2 — CID 123234162
1-[3-[[6-amino-5-(4-methoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]piperidin-1-yl]prop-2-yn-1-one (PubChem CID 123234162) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is 1-[3-[[6-amino-5-(4-methoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]piperidin-1-yl]prop-2-yn-1-one.
| Compound Name | 1-[3-[[6-amino-5-(4-methoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]piperidin-1-yl]prop-2-yn-1-one |
|---|---|
| PubChem CID | 123234162 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 1-[3-[[6-amino-5-(4-methoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]piperidin-1-yl]prop-2-yn-1-one |
| SMILES | [H]/N=C(\c1ccc(OC)cc1)c1c(N)ncnc1NC1CCCN(C(=O)C#C)C1 |
| InChI | InChI=1S/C20H22N6O2/c1-3-16(27)26-10-4-5-14(11-26)25-20-17(19(22)23-12-24-20)18(21)13-6-8-15(28-2)9-7-13/h1,6-9,12,14,21H,4-5,10-11H2,2H3,(H3,22,23,24,25)/b21-18+ |
| InChIKey | WSIFUXCXBOWQFE-DYTRJAOYSA-N |
| XLogP | 1.52 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|