C23H26N6O2 — CID 145184698
5-[4-(4-methoxyphenoxy)benzenecarboximidoyl]-4-N-piperidin-3-ylpyrimidine-4,6-diamine (PubChem CID 145184698) has the molecular formula C23H26N6O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 5-[4-(4-methoxyphenoxy)benzenecarboximidoyl]-4-N-piperidin-3-ylpyrimidine-4,6-diamine.
| Compound Name | 5-[4-(4-methoxyphenoxy)benzenecarboximidoyl]-4-N-piperidin-3-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 145184698 |
| Molecular Formula | C23H26N6O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 5-[4-(4-methoxyphenoxy)benzenecarboximidoyl]-4-N-piperidin-3-ylpyrimidine-4,6-diamine |
| SMILES | [H]/N=C(\c1ccc(Oc2ccc(OC)cc2)cc1)c1c(N)ncnc1NC1CCCNC1 |
| InChI | InChI=1S/C23H26N6O2/c1-30-17-8-10-19(11-9-17)31-18-6-4-15(5-7-18)21(24)20-22(25)27-14-28-23(20)29-16-3-2-12-26-13-16/h4-11,14,16,24,26H,2-3,12-13H2,1H3,(H3,25,27,28,29)/b24-21+ |
| InChIKey | MECPORADGFYBCZ-DARPEHSRSA-N |
| XLogP | 3.44 |
| TPSA | 118.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|