C29H37N7O — CID 167479973
4-N-[1-[(1-methylpiperidin-4-yl)methyl]piperidin-4-yl]-5-(4-phenoxybenzenecarboximidoyl)pyrimidine-4,6-diamine (PubChem CID 167479973) has the molecular formula C29H37N7O and a molecular weight of 499.66 g/mol. Its IUPAC name is 4-N-[1-[(1-methylpiperidin-4-yl)methyl]piperidin-4-yl]-5-(4-phenoxybenzenecarboximidoyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-[1-[(1-methylpiperidin-4-yl)methyl]piperidin-4-yl]-5-(4-phenoxybenzenecarboximidoyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 167479973 |
| Molecular Formula | C29H37N7O |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.31 |
| IUPAC Name | 4-N-[1-[(1-methylpiperidin-4-yl)methyl]piperidin-4-yl]-5-(4-phenoxybenzenecarboximidoyl)pyrimidine-4,6-diamine |
| SMILES | [H]/N=C(\c1ccc(Oc2ccccc2)cc1)c1c(N)ncnc1NC1CCN(CC2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C29H37N7O/c1-35-15-11-21(12-16-35)19-36-17-13-23(14-18-36)34-29-26(28(31)32-20-33-29)27(30)22-7-9-25(10-8-22)37-24-5-3-2-4-6-24/h2-10,20-21,23,30H,11-19H2,1H3,(H3,31,32,33,34)/b30-27+ |
| InChIKey | YQWYOVGLJSGABS-KDJFERLWSA-N |
| XLogP | 4.49 |
| TPSA | 103.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|