C31H39N7O2 — CID 178016273
1-(4-methylpiperazin-1-yl)ethanone;5-(4-phenoxybenzenecarboximidoyl)-4-N-spiro[3.3]heptan-2-ylpyrimidine-4,6-diamine (PubChem CID 178016273) has the molecular formula C31H39N7O2 and a molecular weight of 541.70 g/mol. Its IUPAC name is 1-(4-methylpiperazin-1-yl)ethanone;5-(4-phenoxybenzenecarboximidoyl)-4-N-spiro[3.3]heptan-2-ylpyrimidine-4,6-diamine.
| Compound Name | 1-(4-methylpiperazin-1-yl)ethanone;5-(4-phenoxybenzenecarboximidoyl)-4-N-spiro[3.3]heptan-2-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 178016273 |
| Molecular Formula | C31H39N7O2 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.32 |
| IUPAC Name | 1-(4-methylpiperazin-1-yl)ethanone;5-(4-phenoxybenzenecarboximidoyl)-4-N-spiro[3.3]heptan-2-ylpyrimidine-4,6-diamine |
| SMILES | CC(=O)N1CCN(C)CC1.[H]/N=C(\c1ccc(Oc2ccccc2)cc1)c1c(N)ncnc1NC1CC2(CCC2)C1 |
| InChI | InChI=1S/C24H25N5O.C7H14N2O/c25-21(16-7-9-19(10-8-16)30-18-5-2-1-3-6-18)20-22(26)27-15-28-23(20)29-17-13-24(14-17)11-4-12-24;1-7(10)9-5-3-8(2)4-6-9/h1-3,5-10,15,17,25H,4,11-14H2,(H3,26,27,28,29);3-6H2,1-2H3/b25-21+; |
| InChIKey | MXVRRBAKKQHLQL-JMFMGIQESA-N |
| XLogP | 4.79 |
| TPSA | 120.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|