C28H37N7O — CID 167480287
4-N-[1-(azetidin-3-ylmethyl)piperidin-4-yl]-5-(4-phenoxybenzenecarboximidoyl)pyrimidine-4,6-diamine;ethane (PubChem CID 167480287) has the molecular formula C28H37N7O and a molecular weight of 487.65 g/mol. Its IUPAC name is 4-N-[1-(azetidin-3-ylmethyl)piperidin-4-yl]-5-(4-phenoxybenzenecarboximidoyl)pyrimidine-4,6-diamine;ethane.
| Compound Name | 4-N-[1-(azetidin-3-ylmethyl)piperidin-4-yl]-5-(4-phenoxybenzenecarboximidoyl)pyrimidine-4,6-diamine;ethane |
|---|---|
| PubChem CID | 167480287 |
| Molecular Formula | C28H37N7O |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.31 |
| IUPAC Name | 4-N-[1-(azetidin-3-ylmethyl)piperidin-4-yl]-5-(4-phenoxybenzenecarboximidoyl)pyrimidine-4,6-diamine;ethane |
| SMILES | CC.[H]/N=C(\c1ccc(Oc2ccccc2)cc1)c1c(N)ncnc1NC1CCN(CC2CNC2)CC1 |
| InChI | InChI=1S/C26H31N7O.C2H6/c27-24(19-6-8-22(9-7-19)34-21-4-2-1-3-5-21)23-25(28)30-17-31-26(23)32-20-10-12-33(13-11-20)16-18-14-29-15-18;1-2/h1-9,17-18,20,27,29H,10-16H2,(H3,28,30,31,32);1-2H3/b27-24+; |
| InChIKey | PTUMZSDMHPJDSN-KYYAMWDPSA-N |
| XLogP | 4.39 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|