C30H41N7O2 — CID 145124708
2-amino-4-methylpentanal;4-N-[4-(methylamino)cyclohexyl]-5-(4-phenoxybenzenecarboximidoyl)pyrimidine-4,6-diamine (PubChem CID 145124708) has the molecular formula C30H41N7O2 and a molecular weight of 531.71 g/mol. Its IUPAC name is 2-amino-4-methylpentanal;4-N-[4-(methylamino)cyclohexyl]-5-(4-phenoxybenzenecarboximidoyl)pyrimidine-4,6-diamine.
| Compound Name | 2-amino-4-methylpentanal;4-N-[4-(methylamino)cyclohexyl]-5-(4-phenoxybenzenecarboximidoyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 145124708 |
| Molecular Formula | C30H41N7O2 |
| Molecular Weight | 531.71 g/mol |
| Exact Mass | 531.33 |
| IUPAC Name | 2-amino-4-methylpentanal;4-N-[4-(methylamino)cyclohexyl]-5-(4-phenoxybenzenecarboximidoyl)pyrimidine-4,6-diamine |
| SMILES | CC(C)CC(N)C=O.[H]/N=C(\c1ccc(Oc2ccccc2)cc1)c1c(N)ncnc1NC1CCC(NC)CC1 |
| InChI | InChI=1S/C24H28N6O.C6H13NO/c1-27-17-9-11-18(12-10-17)30-24-21(23(26)28-15-29-24)22(25)16-7-13-20(14-8-16)31-19-5-3-2-4-6-19;1-5(2)3-6(7)4-8/h2-8,13-15,17-18,25,27H,9-12H2,1H3,(H3,26,28,29,30);4-6H,3,7H2,1-2H3/b25-22+; |
| InChIKey | ABPFSPLIJNUHAX-OSMRDGEFSA-N |
| XLogP | 4.77 |
| TPSA | 152.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.71 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|