C27H31F3N6O — CID 170070694
4-N-(1-butan-2-ylpiperidin-4-yl)-5-[4-[4-(trifluoromethyl)phenoxy]benzenecarboximidoyl]pyrimidine-4,6-diamine (PubChem CID 170070694) has the molecular formula C27H31F3N6O and a molecular weight of 512.58 g/mol. Its IUPAC name is 4-N-(1-butan-2-ylpiperidin-4-yl)-5-[4-[4-(trifluoromethyl)phenoxy]benzenecarboximidoyl]pyrimidine-4,6-diamine.
| Compound Name | 4-N-(1-butan-2-ylpiperidin-4-yl)-5-[4-[4-(trifluoromethyl)phenoxy]benzenecarboximidoyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 170070694 |
| Molecular Formula | C27H31F3N6O |
| Molecular Weight | 512.58 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | 4-N-(1-butan-2-ylpiperidin-4-yl)-5-[4-[4-(trifluoromethyl)phenoxy]benzenecarboximidoyl]pyrimidine-4,6-diamine |
| SMILES | [H]/N=C(\c1ccc(Oc2ccc(C(F)(F)F)cc2)cc1)c1c(N)ncnc1NC1CCN(C(C)CC)CC1 |
| InChI | InChI=1S/C27H31F3N6O/c1-3-17(2)36-14-12-20(13-15-36)35-26-23(25(32)33-16-34-26)24(31)18-4-8-21(9-5-18)37-22-10-6-19(7-11-22)27(28,29)30/h4-11,16-17,20,31H,3,12-15H2,1-2H3,(H3,32,33,34,35)/b31-24+ |
| InChIKey | BDQFGJKAHPADGD-QFMPWRQOSA-N |
| XLogP | 5.96 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.58 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|