C28H35N7O2 — CID 145124779
N-[2-amino-4-[[6-amino-5-(4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]cyclohexyl]pentanamide (PubChem CID 145124779) has the molecular formula C28H35N7O2 and a molecular weight of 501.64 g/mol. Its IUPAC name is N-[2-amino-4-[[6-amino-5-(4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]cyclohexyl]pentanamide.
| Compound Name | N-[2-amino-4-[[6-amino-5-(4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]cyclohexyl]pentanamide |
|---|---|
| PubChem CID | 145124779 |
| Molecular Formula | C28H35N7O2 |
| Molecular Weight | 501.64 g/mol |
| Exact Mass | 501.29 |
| IUPAC Name | N-[2-amino-4-[[6-amino-5-(4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]cyclohexyl]pentanamide |
| SMILES | [H]/N=C(\c1ccc(Oc2ccccc2)cc1)c1c(N)ncnc1NC1CCC(NC(=O)CCCC)C(N)C1 |
| InChI | InChI=1S/C28H35N7O2/c1-2-3-9-24(36)35-23-15-12-19(16-22(23)29)34-28-25(27(31)32-17-33-28)26(30)18-10-13-21(14-11-18)37-20-7-5-4-6-8-20/h4-8,10-11,13-14,17,19,22-23,30H,2-3,9,12,15-16,29H2,1H3,(H,35,36)(H3,31,32,33,34)/b30-26+ |
| InChIKey | XDEUHXKPJJKODI-URGPHPNLSA-N |
| XLogP | 4.23 |
| TPSA | 152.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.64 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|