C28H23F5N6O3S — CID 155578351
4-N-[1-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperidin-3-yl]-5-(4-phenoxybenzenecarboximidoyl)pyrimidine-4,6-diamine (PubChem CID 155578351) has the molecular formula C28H23F5N6O3S and a molecular weight of 618.59 g/mol. Its IUPAC name is 4-N-[1-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperidin-3-yl]-5-(4-phenoxybenzenecarboximidoyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-[1-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperidin-3-yl]-5-(4-phenoxybenzenecarboximidoyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 155578351 |
| Molecular Formula | C28H23F5N6O3S |
| Molecular Weight | 618.59 g/mol |
| Exact Mass | 618.15 |
| IUPAC Name | 4-N-[1-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperidin-3-yl]-5-(4-phenoxybenzenecarboximidoyl)pyrimidine-4,6-diamine |
| SMILES | [H]/N=C(\c1ccc(Oc2ccccc2)cc1)c1c(N)ncnc1NC1CCCN(S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)C1 |
| InChI | InChI=1S/C28H23F5N6O3S/c29-20-21(30)23(32)26(24(33)22(20)31)43(40,41)39-12-4-5-16(13-39)38-28-19(27(35)36-14-37-28)25(34)15-8-10-18(11-9-15)42-17-6-2-1-3-7-17/h1-3,6-11,14,16,34H,4-5,12-13H2,(H3,35,36,37,38)/b34-25+ |
| InChIKey | MQIUPMSEWSJZIJ-YQCHCMBFSA-N |
| XLogP | 5.23 |
| TPSA | 134.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.59 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|